C21H21F4N3O5S2 — CID 19678371
methyl 6-methyl-2-[[3-nitro-5-(2,2,3,3-tetrafluoropropoxy)phenyl]carbamothioylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 19678371) has the molecular formula C21H21F4N3O5S2 and a molecular weight of 535.54 g/mol. Its IUPAC name is methyl 6-methyl-2-[[3-nitro-5-(2,2,3,3-tetrafluoropropoxy)phenyl]carbamothioylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | methyl 6-methyl-2-[[3-nitro-5-(2,2,3,3-tetrafluoropropoxy)phenyl]carbamothioylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 19678371 |
| Molecular Formula | C21H21F4N3O5S2 |
| Molecular Weight | 535.54 g/mol |
| Exact Mass | 535.09 |
| IUPAC Name | methyl 6-methyl-2-[[3-nitro-5-(2,2,3,3-tetrafluoropropoxy)phenyl]carbamothioylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=S)Nc2cc(OCC(F)(F)C(F)F)cc([N+](=O)[O-])c2)sc2c1CCC(C)C2 |
| InChI | InChI=1S/C21H21F4N3O5S2/c1-10-3-4-14-15(5-10)35-17(16(14)18(29)32-2)27-20(34)26-11-6-12(28(30)31)8-13(7-11)33-9-21(24,25)19(22)23/h6-8,10,19H,3-5,9H2,1-2H3,(H2,26,27,34) |
| InChIKey | LIUOROJWKLMIBV-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 102.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.54 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|