C21H22F3N3O5S2 — CID 19678276
methyl 2-[[3-nitro-5-(2,2,2-trifluoroethoxy)phenyl]carbamothioylamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate (PubChem CID 19678276) has the molecular formula C21H22F3N3O5S2 and a molecular weight of 517.55 g/mol. Its IUPAC name is methyl 2-[[3-nitro-5-(2,2,2-trifluoroethoxy)phenyl]carbamothioylamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate.
| Compound Name | methyl 2-[[3-nitro-5-(2,2,2-trifluoroethoxy)phenyl]carbamothioylamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19678276 |
| Molecular Formula | C21H22F3N3O5S2 |
| Molecular Weight | 517.55 g/mol |
| Exact Mass | 517.10 |
| IUPAC Name | methyl 2-[[3-nitro-5-(2,2,2-trifluoroethoxy)phenyl]carbamothioylamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=S)Nc2cc(OCC(F)(F)F)cc([N+](=O)[O-])c2)sc2c1CCCCCC2 |
| InChI | InChI=1S/C21H22F3N3O5S2/c1-31-19(28)17-15-6-4-2-3-5-7-16(15)34-18(17)26-20(33)25-12-8-13(27(29)30)10-14(9-12)32-11-21(22,23)24/h8-10H,2-7,11H2,1H3,(H2,25,26,33) |
| InChIKey | XGTPSTLQMNTJRO-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 102.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.55 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|