C16H14FN3O4S2 — CID 17300481
methyl 2-[(4-fluoro-2-nitrophenyl)carbamothioylamino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate (PubChem CID 17300481) has the molecular formula C16H14FN3O4S2 and a molecular weight of 395.44 g/mol. Its IUPAC name is methyl 2-[(4-fluoro-2-nitrophenyl)carbamothioylamino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate.
| Compound Name | methyl 2-[(4-fluoro-2-nitrophenyl)carbamothioylamino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 17300481 |
| Molecular Formula | C16H14FN3O4S2 |
| Molecular Weight | 395.44 g/mol |
| Exact Mass | 395.04 |
| IUPAC Name | methyl 2-[(4-fluoro-2-nitrophenyl)carbamothioylamino]-5,6-dihydro-4H-cyclopenta[b]thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=S)Nc2ccc(F)cc2[N+](=O)[O-])sc2c1CCC2 |
| InChI | InChI=1S/C16H14FN3O4S2/c1-24-15(21)13-9-3-2-4-12(9)26-14(13)19-16(25)18-10-6-5-8(17)7-11(10)20(22)23/h5-7H,2-4H2,1H3,(H2,18,19,25) |
| InChIKey | RBERIVCVEZCZFM-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.44 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|