C15H5Cl4N5O4 — CID 90307341
2,4,5-trichloro-6-(3-chloro-2-methyl-4,6-dinitroanilino)benzene-1,3-dicarbonitrile (PubChem CID 90307341) has the molecular formula C15H5Cl4N5O4 and a molecular weight of 461.05 g/mol. Its IUPAC name is 2,4,5-trichloro-6-(3-chloro-2-methyl-4,6-dinitroanilino)benzene-1,3-dicarbonitrile.
| Compound Name | 2,4,5-trichloro-6-(3-chloro-2-methyl-4,6-dinitroanilino)benzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 90307341 |
| Molecular Formula | C15H5Cl4N5O4 |
| Molecular Weight | 461.05 g/mol |
| Exact Mass | 458.91 |
| IUPAC Name | 2,4,5-trichloro-6-(3-chloro-2-methyl-4,6-dinitroanilino)benzene-1,3-dicarbonitrile |
| SMILES | Cc1c(Cl)c([N+](=O)[O-])cc([N+](=O)[O-])c1Nc1c(Cl)c(Cl)c(C#N)c(Cl)c1C#N |
| InChI | InChI=1S/C15H5Cl4N5O4/c1-5-10(16)8(23(25)26)2-9(24(27)28)14(5)22-15-7(4-21)11(17)6(3-20)12(18)13(15)19/h2,22H,1H3 |
| InChIKey | JRIWWPWTXNQGRS-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 145.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.05 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|