C14H5ClF2N4O2 — CID 89305100
5-chloro-2,4-difluoro-6-(4-nitroanilino)benzene-1,3-dicarbonitrile (PubChem CID 89305100) has the molecular formula C14H5ClF2N4O2 and a molecular weight of 334.67 g/mol. Its IUPAC name is 5-chloro-2,4-difluoro-6-(4-nitroanilino)benzene-1,3-dicarbonitrile.
| Compound Name | 5-chloro-2,4-difluoro-6-(4-nitroanilino)benzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 89305100 |
| Molecular Formula | C14H5ClF2N4O2 |
| Molecular Weight | 334.67 g/mol |
| Exact Mass | 334.01 |
| IUPAC Name | 5-chloro-2,4-difluoro-6-(4-nitroanilino)benzene-1,3-dicarbonitrile |
| SMILES | N#Cc1c(F)c(Cl)c(Nc2ccc([N+](=O)[O-])cc2)c(C#N)c1F |
| InChI | InChI=1S/C14H5ClF2N4O2/c15-11-13(17)9(5-18)12(16)10(6-19)14(11)20-7-1-3-8(4-2-7)21(22)23/h1-4,20H |
| InChIKey | KRGSWKNFSYUYLV-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 102.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.67 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|