C13H6Cl2FN3O2 — CID 83078079
5-(2,6-dichloro-4-fluoroanilino)-2-nitrobenzonitrile (PubChem CID 83078079) has the molecular formula C13H6Cl2FN3O2 and a molecular weight of 326.11 g/mol. Its IUPAC name is 5-(2,6-dichloro-4-fluoroanilino)-2-nitrobenzonitrile.
| Compound Name | 5-(2,6-dichloro-4-fluoroanilino)-2-nitrobenzonitrile |
|---|---|
| PubChem CID | 83078079 |
| Molecular Formula | C13H6Cl2FN3O2 |
| Molecular Weight | 326.11 g/mol |
| Exact Mass | 324.98 |
| IUPAC Name | 5-(2,6-dichloro-4-fluoroanilino)-2-nitrobenzonitrile |
| SMILES | N#Cc1cc(Nc2c(Cl)cc(F)cc2Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H6Cl2FN3O2/c14-10-4-8(16)5-11(15)13(10)18-9-1-2-12(19(20)21)7(3-9)6-17/h1-5,18H |
| InChIKey | OXQUXPNIMYGKRP-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 78.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.11 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|