C12H6F3IN2O2 — CID 106494562
2,4,6-trifluoro-N-(3-iodo-4-nitrophenyl)aniline (PubChem CID 106494562) has the molecular formula C12H6F3IN2O2 and a molecular weight of 394.09 g/mol. Its IUPAC name is 2,4,6-trifluoro-N-(3-iodo-4-nitrophenyl)aniline.
| Compound Name | 2,4,6-trifluoro-N-(3-iodo-4-nitrophenyl)aniline |
|---|---|
| PubChem CID | 106494562 |
| Molecular Formula | C12H6F3IN2O2 |
| Molecular Weight | 394.09 g/mol |
| Exact Mass | 393.94 |
| IUPAC Name | 2,4,6-trifluoro-N-(3-iodo-4-nitrophenyl)aniline |
| SMILES | O=[N+]([O-])c1ccc(Nc2c(F)cc(F)cc2F)cc1I |
| InChI | InChI=1S/C12H6F3IN2O2/c13-6-3-8(14)12(9(15)4-6)17-7-1-2-11(18(19)20)10(16)5-7/h1-5,17H |
| InChIKey | BHXDLBGFCRLAGA-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.09 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|