C14H12BrIN2O2 — CID 107576779
4-bromo-N-(3-iodo-4-nitrophenyl)-3,5-dimethylaniline (PubChem CID 107576779) has the molecular formula C14H12BrIN2O2 and a molecular weight of 447.07 g/mol. Its IUPAC name is 4-bromo-N-(3-iodo-4-nitrophenyl)-3,5-dimethylaniline.
| Compound Name | 4-bromo-N-(3-iodo-4-nitrophenyl)-3,5-dimethylaniline |
|---|---|
| PubChem CID | 107576779 |
| Molecular Formula | C14H12BrIN2O2 |
| Molecular Weight | 447.07 g/mol |
| Exact Mass | 445.91 |
| IUPAC Name | 4-bromo-N-(3-iodo-4-nitrophenyl)-3,5-dimethylaniline |
| SMILES | Cc1cc(Nc2ccc([N+](=O)[O-])c(I)c2)cc(C)c1Br |
| InChI | InChI=1S/C14H12BrIN2O2/c1-8-5-11(6-9(2)14(8)15)17-10-3-4-13(18(19)20)12(16)7-10/h3-7,17H,1-2H3 |
| InChIKey | UDTZNMIAACJCBB-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.07 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|