C14H13IN2O2 — CID 106493948
N-(3-iodo-4-nitrophenyl)-2,3-dimethylaniline (PubChem CID 106493948) has the molecular formula C14H13IN2O2 and a molecular weight of 368.17 g/mol. Its IUPAC name is N-(3-iodo-4-nitrophenyl)-2,3-dimethylaniline.
| Compound Name | N-(3-iodo-4-nitrophenyl)-2,3-dimethylaniline |
|---|---|
| PubChem CID | 106493948 |
| Molecular Formula | C14H13IN2O2 |
| Molecular Weight | 368.17 g/mol |
| Exact Mass | 368.00 |
| IUPAC Name | N-(3-iodo-4-nitrophenyl)-2,3-dimethylaniline |
| SMILES | Cc1cccc(Nc2ccc([N+](=O)[O-])c(I)c2)c1C |
| InChI | InChI=1S/C14H13IN2O2/c1-9-4-3-5-13(10(9)2)16-11-6-7-14(17(18)19)12(15)8-11/h3-8,16H,1-2H3 |
| InChIKey | YGRROJSKZQAJIU-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.17 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|