C12H6ClIN4O2S — CID 106494539
5-chloro-N-(3-iodo-4-nitrophenyl)-2,1,3-benzothiadiazol-4-amine (PubChem CID 106494539) has the molecular formula C12H6ClIN4O2S and a molecular weight of 432.63 g/mol. Its IUPAC name is 5-chloro-N-(3-iodo-4-nitrophenyl)-2,1,3-benzothiadiazol-4-amine.
| Compound Name | 5-chloro-N-(3-iodo-4-nitrophenyl)-2,1,3-benzothiadiazol-4-amine |
|---|---|
| PubChem CID | 106494539 |
| Molecular Formula | C12H6ClIN4O2S |
| Molecular Weight | 432.63 g/mol |
| Exact Mass | 431.89 |
| IUPAC Name | 5-chloro-N-(3-iodo-4-nitrophenyl)-2,1,3-benzothiadiazol-4-amine |
| SMILES | O=[N+]([O-])c1ccc(Nc2c(Cl)ccc3nsnc23)cc1I |
| InChI | InChI=1S/C12H6ClIN4O2S/c13-7-2-3-9-12(17-21-16-9)11(7)15-6-1-4-10(18(19)20)8(14)5-6/h1-5,15H |
| InChIKey | QZNWNYYTESJRTM-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 80.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.63 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|