C10H10F3IN2O2 — CID 103710833
3-iodo-4-nitro-N-(4,4,4-trifluorobutyl)aniline (PubChem CID 103710833) has the molecular formula C10H10F3IN2O2 and a molecular weight of 374.10 g/mol. Its IUPAC name is 3-iodo-4-nitro-N-(4,4,4-trifluorobutyl)aniline.
| Compound Name | 3-iodo-4-nitro-N-(4,4,4-trifluorobutyl)aniline |
|---|---|
| PubChem CID | 103710833 |
| Molecular Formula | C10H10F3IN2O2 |
| Molecular Weight | 374.10 g/mol |
| Exact Mass | 373.97 |
| IUPAC Name | 3-iodo-4-nitro-N-(4,4,4-trifluorobutyl)aniline |
| SMILES | O=[N+]([O-])c1ccc(NCCCC(F)(F)F)cc1I |
| InChI | InChI=1S/C10H10F3IN2O2/c11-10(12,13)4-1-5-15-7-2-3-9(16(17)18)8(14)6-7/h2-3,6,15H,1,4-5H2 |
| InChIKey | VUMHNJUHTGHBGW-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.10 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|