About 6-nitro-N-(4,4,4-trifluorobutyl)pyridin-3-amine
6-nitro-N-(4,4,4-trifluorobutyl)pyridin-3-amine (PubChem CID 79040122) has the molecular formula C9H10F3N3O2
and a molecular weight of 249.19 g/mol. Its IUPAC name is 6-nitro-N-(4,4,4-trifluorobutyl)pyridin-3-amine.
Molecular Properties
| Compound Name | 6-nitro-N-(4,4,4-trifluorobutyl)pyridin-3-amine |
| PubChem CID | 79040122 |
| Molecular Formula | C9H10F3N3O2 |
| Molecular Weight | 249.19 g/mol |
| Exact Mass | 249.07 |
| IUPAC Name | 6-nitro-N-(4,4,4-trifluorobutyl)pyridin-3-amine |
| SMILES | O=[N+]([O-])c1ccc(NCCCC(F)(F)F)cn1 |
| InChI | InChI=1S/C9H10F3N3O2/c10-9(11,12)4-1-5-13-7-2-3-8(14-6-7)15(16)17/h2-3,6,13H,1,4-5H2 |
| InChIKey | HANLDBXJZZFWLZ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 68.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.19 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-nitro-N-(4,4,4-trifluorobutyl)pyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-nitro-N-(4,4,4-trifluorobutyl)pyridin-3-amine?
The IUPAC name of 6-nitro-N-(4,4,4-trifluorobutyl)pyridin-3-amine (CID 79040122) is 6-nitro-N-(4,4,4-trifluorobutyl)pyridin-3-amine.
What is the SMILES notation for 6-nitro-N-(4,4,4-trifluorobutyl)pyridin-3-amine?
The canonical SMILES for 6-nitro-N-(4,4,4-trifluorobutyl)pyridin-3-amine is O=[N+]([O-])c1ccc(NCCCC(F)(F)F)cn1.
What is the InChIKey of 6-nitro-N-(4,4,4-trifluorobutyl)pyridin-3-amine?
The InChIKey is HANLDBXJZZFWLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10F3N3O2/c10-9(11,12)4-1-5-13-7-2-3-8(14-6-7)15(16)17/h2-3,6,13H,1,4-5H2.
What are the key properties of 6-nitro-N-(4,4,4-trifluorobutyl)pyridin-3-amine?
6-nitro-N-(4,4,4-trifluorobutyl)pyridin-3-amine has a molecular weight of 249.19 g/mol, XLogP of 2.74, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-nitro-N-(4,4,4-trifluorobutyl)pyridin-3-amine is sourced from PubChem (CID 79040122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).