C11H10F3N3O2 — CID 115519692
2-nitro-4-(4,4,4-trifluorobutylamino)benzonitrile (PubChem CID 115519692) has the molecular formula C11H10F3N3O2 and a molecular weight of 273.21 g/mol. Its IUPAC name is 2-nitro-4-(4,4,4-trifluorobutylamino)benzonitrile.
| Compound Name | 2-nitro-4-(4,4,4-trifluorobutylamino)benzonitrile |
|---|---|
| PubChem CID | 115519692 |
| Molecular Formula | C11H10F3N3O2 |
| Molecular Weight | 273.21 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | 2-nitro-4-(4,4,4-trifluorobutylamino)benzonitrile |
| SMILES | N#Cc1ccc(NCCCC(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H10F3N3O2/c12-11(13,14)4-1-5-16-9-3-2-8(7-15)10(6-9)17(18)19/h2-3,6,16H,1,4-5H2 |
| InChIKey | QIUMQEFQAMCHFO-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 78.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.21 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|