C10H9Cl2F3N2O2 — CID 115520545
4,5-dichloro-2-nitro-N-(4,4,4-trifluorobutyl)aniline (PubChem CID 115520545) has the molecular formula C10H9Cl2F3N2O2 and a molecular weight of 317.09 g/mol. Its IUPAC name is 4,5-dichloro-2-nitro-N-(4,4,4-trifluorobutyl)aniline.
| Compound Name | 4,5-dichloro-2-nitro-N-(4,4,4-trifluorobutyl)aniline |
|---|---|
| PubChem CID | 115520545 |
| Molecular Formula | C10H9Cl2F3N2O2 |
| Molecular Weight | 317.09 g/mol |
| Exact Mass | 316.00 |
| IUPAC Name | 4,5-dichloro-2-nitro-N-(4,4,4-trifluorobutyl)aniline |
| SMILES | O=[N+]([O-])c1cc(Cl)c(Cl)cc1NCCCC(F)(F)F |
| InChI | InChI=1S/C10H9Cl2F3N2O2/c11-6-4-8(9(17(18)19)5-7(6)12)16-3-1-2-10(13,14)15/h4-5,16H,1-3H2 |
| InChIKey | GQOQUIQVYPFZNL-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.09 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|