C9H7Cl2F3N2O2S — CID 106430921
4,5-dichloro-2-nitro-N-[2-(trifluoromethylsulfanyl)ethyl]aniline (PubChem CID 106430921) has the molecular formula C9H7Cl2F3N2O2S and a molecular weight of 335.13 g/mol. Its IUPAC name is 4,5-dichloro-2-nitro-N-[2-(trifluoromethylsulfanyl)ethyl]aniline.
| Compound Name | 4,5-dichloro-2-nitro-N-[2-(trifluoromethylsulfanyl)ethyl]aniline |
|---|---|
| PubChem CID | 106430921 |
| Molecular Formula | C9H7Cl2F3N2O2S |
| Molecular Weight | 335.13 g/mol |
| Exact Mass | 333.96 |
| IUPAC Name | 4,5-dichloro-2-nitro-N-[2-(trifluoromethylsulfanyl)ethyl]aniline |
| SMILES | O=[N+]([O-])c1cc(Cl)c(Cl)cc1NCCSC(F)(F)F |
| InChI | InChI=1S/C9H7Cl2F3N2O2S/c10-5-3-7(8(16(17)18)4-6(5)11)15-1-2-19-9(12,13)14/h3-4,15H,1-2H2 |
| InChIKey | ABKXDTNOFAEAMS-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.13 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|