C11H11F3N2O4S — CID 106429648
4-methyl-3-nitro-5-[2-(trifluoromethylsulfanyl)ethylamino]benzoic acid (PubChem CID 106429648) has the molecular formula C11H11F3N2O4S and a molecular weight of 324.28 g/mol. Its IUPAC name is 4-methyl-3-nitro-5-[2-(trifluoromethylsulfanyl)ethylamino]benzoic acid.
| Compound Name | 4-methyl-3-nitro-5-[2-(trifluoromethylsulfanyl)ethylamino]benzoic acid |
|---|---|
| PubChem CID | 106429648 |
| Molecular Formula | C11H11F3N2O4S |
| Molecular Weight | 324.28 g/mol |
| Exact Mass | 324.04 |
| IUPAC Name | 4-methyl-3-nitro-5-[2-(trifluoromethylsulfanyl)ethylamino]benzoic acid |
| SMILES | Cc1c(NCCSC(F)(F)F)cc(C(=O)O)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H11F3N2O4S/c1-6-8(15-2-3-21-11(12,13)14)4-7(10(17)18)5-9(6)16(19)20/h4-5,15H,2-3H2,1H3,(H,17,18) |
| InChIKey | UDPORBNOYINEGJ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.28 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|