C12H14F4N2O2 — CID 103591828
4-fluoro-5-methyl-2-nitro-N-(5,5,5-trifluoropentyl)aniline (PubChem CID 103591828) has the molecular formula C12H14F4N2O2 and a molecular weight of 294.25 g/mol. Its IUPAC name is 4-fluoro-5-methyl-2-nitro-N-(5,5,5-trifluoropentyl)aniline.
| Compound Name | 4-fluoro-5-methyl-2-nitro-N-(5,5,5-trifluoropentyl)aniline |
|---|---|
| PubChem CID | 103591828 |
| Molecular Formula | C12H14F4N2O2 |
| Molecular Weight | 294.25 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 4-fluoro-5-methyl-2-nitro-N-(5,5,5-trifluoropentyl)aniline |
| SMILES | Cc1cc(NCCCCC(F)(F)F)c([N+](=O)[O-])cc1F |
| InChI | InChI=1S/C12H14F4N2O2/c1-8-6-10(11(18(19)20)7-9(8)13)17-5-3-2-4-12(14,15)16/h6-7,17H,2-5H2,1H3 |
| InChIKey | KXHXZJVFMHXUEC-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.25 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|