C12H7ClN4O6 — CID 70682761
5-chloro-2,4-dinitro-N-(4-nitrophenyl)aniline (PubChem CID 70682761) has the molecular formula C12H7ClN4O6 and a molecular weight of 338.66 g/mol. Its IUPAC name is 5-chloro-2,4-dinitro-N-(4-nitrophenyl)aniline.
| Compound Name | 5-chloro-2,4-dinitro-N-(4-nitrophenyl)aniline |
|---|---|
| PubChem CID | 70682761 |
| Molecular Formula | C12H7ClN4O6 |
| Molecular Weight | 338.66 g/mol |
| Exact Mass | 338.01 |
| IUPAC Name | 5-chloro-2,4-dinitro-N-(4-nitrophenyl)aniline |
| SMILES | O=[N+]([O-])c1ccc(Nc2cc(Cl)c([N+](=O)[O-])cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C12H7ClN4O6/c13-9-5-10(12(17(22)23)6-11(9)16(20)21)14-7-1-3-8(4-2-7)15(18)19/h1-6,14H |
| InChIKey | LJCXUHJFYDCJFD-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 141.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.66 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|