C12H7Cl3N4O4 — CID 91596753
1-(2-chloro-4-nitrophenyl)-2-(2,5-dichloro-4-nitrophenyl)hydrazine (PubChem CID 91596753) has the molecular formula C12H7Cl3N4O4 and a molecular weight of 377.57 g/mol. Its IUPAC name is 1-(2-chloro-4-nitrophenyl)-2-(2,5-dichloro-4-nitrophenyl)hydrazine.
| Compound Name | 1-(2-chloro-4-nitrophenyl)-2-(2,5-dichloro-4-nitrophenyl)hydrazine |
|---|---|
| PubChem CID | 91596753 |
| Molecular Formula | C12H7Cl3N4O4 |
| Molecular Weight | 377.57 g/mol |
| Exact Mass | 375.95 |
| IUPAC Name | 1-(2-chloro-4-nitrophenyl)-2-(2,5-dichloro-4-nitrophenyl)hydrazine |
| SMILES | O=[N+]([O-])c1ccc(NNc2cc(Cl)c([N+](=O)[O-])cc2Cl)c(Cl)c1 |
| InChI | InChI=1S/C12H7Cl3N4O4/c13-7-3-6(18(20)21)1-2-10(7)16-17-11-4-9(15)12(19(22)23)5-8(11)14/h1-5,16-17H |
| InChIKey | AJXWYOAQFBLCIU-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 110.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.57 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|