C15H4Cl4F3N3 — CID 89304215
2,4,5-trichloro-6-[2-chloro-4-(trifluoromethyl)anilino]benzene-1,3-dicarbonitrile (PubChem CID 89304215) has the molecular formula C15H4Cl4F3N3 and a molecular weight of 425.02 g/mol. Its IUPAC name is 2,4,5-trichloro-6-[2-chloro-4-(trifluoromethyl)anilino]benzene-1,3-dicarbonitrile.
| Compound Name | 2,4,5-trichloro-6-[2-chloro-4-(trifluoromethyl)anilino]benzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 89304215 |
| Molecular Formula | C15H4Cl4F3N3 |
| Molecular Weight | 425.02 g/mol |
| Exact Mass | 422.91 |
| IUPAC Name | 2,4,5-trichloro-6-[2-chloro-4-(trifluoromethyl)anilino]benzene-1,3-dicarbonitrile |
| SMILES | N#Cc1c(Cl)c(Cl)c(Nc2ccc(C(F)(F)F)cc2Cl)c(C#N)c1Cl |
| InChI | InChI=1S/C15H4Cl4F3N3/c16-9-3-6(15(20,21)22)1-2-10(9)25-14-8(5-24)11(17)7(4-23)12(18)13(14)19/h1-3,25H |
| InChIKey | RYYDVKLFMBWICM-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 59.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.02 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|