C12H7ClF3N3 — CID 67703161
2-[[2-chloro-4-(trifluoromethyl)anilino]methylidene]butanedinitrile (PubChem CID 67703161) has the molecular formula C12H7ClF3N3 and a molecular weight of 285.66 g/mol. Its IUPAC name is 2-[[2-chloro-4-(trifluoromethyl)anilino]methylidene]butanedinitrile.
| Compound Name | 2-[[2-chloro-4-(trifluoromethyl)anilino]methylidene]butanedinitrile |
|---|---|
| PubChem CID | 67703161 |
| Molecular Formula | C12H7ClF3N3 |
| Molecular Weight | 285.66 g/mol |
| Exact Mass | 285.03 |
| IUPAC Name | 2-[[2-chloro-4-(trifluoromethyl)anilino]methylidene]butanedinitrile |
| SMILES | N#CCC(C#N)=CNc1ccc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C12H7ClF3N3/c13-10-5-9(12(14,15)16)1-2-11(10)19-7-8(6-18)3-4-17/h1-2,5,7,19H,3H2 |
| InChIKey | OSVKMGQXTFSRFM-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 59.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.66 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|