C14H13ClF3NO2S — CID 4993542
2-tert-butylsulfonyl-3-[2-chloro-4-(trifluoromethyl)phenyl]prop-2-enenitrile (PubChem CID 4993542) has the molecular formula C14H13ClF3NO2S and a molecular weight of 351.78 g/mol. Its IUPAC name is 2-tert-butylsulfonyl-3-[2-chloro-4-(trifluoromethyl)phenyl]prop-2-enenitrile.
| Compound Name | 2-tert-butylsulfonyl-3-[2-chloro-4-(trifluoromethyl)phenyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 4993542 |
| Molecular Formula | C14H13ClF3NO2S |
| Molecular Weight | 351.78 g/mol |
| Exact Mass | 351.03 |
| IUPAC Name | 2-tert-butylsulfonyl-3-[2-chloro-4-(trifluoromethyl)phenyl]prop-2-enenitrile |
| SMILES | CC(C)(C)S(=O)(=O)C(C#N)=Cc1ccc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C14H13ClF3NO2S/c1-13(2,3)22(20,21)11(8-19)6-9-4-5-10(7-12(9)15)14(16,17)18/h4-7H,1-3H3 |
| InChIKey | GQYWSPGOSQQVNJ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 57.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.78 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|