C13H15Cl2N3O4S2 — CID 2819481
N'-[(E)-2-tert-butylsulfonyl-2-cyanoethenyl]-3,4-dichlorobenzenesulfonohydrazide (PubChem CID 2819481) has the molecular formula C13H15Cl2N3O4S2 and a molecular weight of 412.32 g/mol. Its IUPAC name is N'-[(E)-2-tert-butylsulfonyl-2-cyanoethenyl]-3,4-dichlorobenzenesulfonohydrazide.
| Compound Name | N'-[(E)-2-tert-butylsulfonyl-2-cyanoethenyl]-3,4-dichlorobenzenesulfonohydrazide |
|---|---|
| PubChem CID | 2819481 |
| Molecular Formula | C13H15Cl2N3O4S2 |
| Molecular Weight | 412.32 g/mol |
| Exact Mass | 410.99 |
| IUPAC Name | N'-[(E)-2-tert-butylsulfonyl-2-cyanoethenyl]-3,4-dichlorobenzenesulfonohydrazide |
| SMILES | CC(C)(C)S(=O)(=O)/C(C#N)=C/NNS(=O)(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C13H15Cl2N3O4S2/c1-13(2,3)23(19,20)10(7-16)8-17-18-24(21,22)9-4-5-11(14)12(15)6-9/h4-6,8,17-18H,1-3H3/b10-8+ |
| InChIKey | NCOMIFVMLOSHQB-CSKARUKUSA-N |
| XLogP | 2.35 |
| TPSA | 116.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.32 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|