C22H25F3N2O2S — CID 142674711
(E)-2-tert-butylsulfonyl-3-[2-methyl-5-propan-2-yl-1-[2-(trifluoromethyl)phenyl]pyrrol-3-yl]prop-2-enenitrile (PubChem CID 142674711) has the molecular formula C22H25F3N2O2S and a molecular weight of 438.52 g/mol. Its IUPAC name is (E)-2-tert-butylsulfonyl-3-[2-methyl-5-propan-2-yl-1-[2-(trifluoromethyl)phenyl]pyrrol-3-yl]prop-2-enenitrile.
| Compound Name | (E)-2-tert-butylsulfonyl-3-[2-methyl-5-propan-2-yl-1-[2-(trifluoromethyl)phenyl]pyrrol-3-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 142674711 |
| Molecular Formula | C22H25F3N2O2S |
| Molecular Weight | 438.52 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | (E)-2-tert-butylsulfonyl-3-[2-methyl-5-propan-2-yl-1-[2-(trifluoromethyl)phenyl]pyrrol-3-yl]prop-2-enenitrile |
| SMILES | Cc1c(/C=C(\C#N)S(=O)(=O)C(C)(C)C)cc(C(C)C)n1-c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C22H25F3N2O2S/c1-14(2)20-12-16(11-17(13-26)30(28,29)21(4,5)6)15(3)27(20)19-10-8-7-9-18(19)22(23,24)25/h7-12,14H,1-6H3/b17-11+ |
| InChIKey | HXNWHSNEIONQMO-GZTJUZNOSA-N |
| XLogP | 6.01 |
| TPSA | 62.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.52 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|