C25H20F6N2O2S — CID 142674747
(E)-2-(benzenesulfonyl)-3-[1-[3,5-bis(trifluoromethyl)phenyl]-2-methyl-5-propan-2-ylpyrrol-3-yl]prop-2-enenitrile (PubChem CID 142674747) has the molecular formula C25H20F6N2O2S and a molecular weight of 526.50 g/mol. Its IUPAC name is (E)-2-(benzenesulfonyl)-3-[1-[3,5-bis(trifluoromethyl)phenyl]-2-methyl-5-propan-2-ylpyrrol-3-yl]prop-2-enenitrile.
| Compound Name | (E)-2-(benzenesulfonyl)-3-[1-[3,5-bis(trifluoromethyl)phenyl]-2-methyl-5-propan-2-ylpyrrol-3-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 142674747 |
| Molecular Formula | C25H20F6N2O2S |
| Molecular Weight | 526.50 g/mol |
| Exact Mass | 526.11 |
| IUPAC Name | (E)-2-(benzenesulfonyl)-3-[1-[3,5-bis(trifluoromethyl)phenyl]-2-methyl-5-propan-2-ylpyrrol-3-yl]prop-2-enenitrile |
| SMILES | Cc1c(/C=C(\C#N)S(=O)(=O)c2ccccc2)cc(C(C)C)n1-c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C25H20F6N2O2S/c1-15(2)23-10-17(9-22(14-32)36(34,35)21-7-5-4-6-8-21)16(3)33(23)20-12-18(24(26,27)28)11-19(13-20)25(29,30)31/h4-13,15H,1-3H3/b22-9+ |
| InChIKey | AFSBMSKWFZETGL-LSFURLLWSA-N |
| XLogP | 7.29 |
| TPSA | 62.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.50 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|