C25H20F3N3O3S — CID 142674899
2-[3-[(E)-2-cyano-2-[2-(trifluoromethoxy)phenyl]sulfonylethenyl]-2-methyl-5-propan-2-ylpyrrol-1-yl]benzonitrile (PubChem CID 142674899) has the molecular formula C25H20F3N3O3S and a molecular weight of 499.51 g/mol. Its IUPAC name is 2-[3-[(E)-2-cyano-2-[2-(trifluoromethoxy)phenyl]sulfonylethenyl]-2-methyl-5-propan-2-ylpyrrol-1-yl]benzonitrile.
| Compound Name | 2-[3-[(E)-2-cyano-2-[2-(trifluoromethoxy)phenyl]sulfonylethenyl]-2-methyl-5-propan-2-ylpyrrol-1-yl]benzonitrile |
|---|---|
| PubChem CID | 142674899 |
| Molecular Formula | C25H20F3N3O3S |
| Molecular Weight | 499.51 g/mol |
| Exact Mass | 499.12 |
| IUPAC Name | 2-[3-[(E)-2-cyano-2-[2-(trifluoromethoxy)phenyl]sulfonylethenyl]-2-methyl-5-propan-2-ylpyrrol-1-yl]benzonitrile |
| SMILES | Cc1c(/C=C(\C#N)S(=O)(=O)c2ccccc2OC(F)(F)F)cc(C(C)C)n1-c1ccccc1C#N |
| InChI | InChI=1S/C25H20F3N3O3S/c1-16(2)22-13-19(17(3)31(22)21-9-5-4-8-18(21)14-29)12-20(15-30)35(32,33)24-11-7-6-10-23(24)34-25(26,27)28/h4-13,16H,1-3H3/b20-12+ |
| InChIKey | FPLFAXAGKUQUIA-UDWIEESQSA-N |
| XLogP | 6.02 |
| TPSA | 95.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.51 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|