C24H24N2O3S — CID 142674907
(E)-2-(benzenesulfonyl)-3-[1-(2-methoxyphenyl)-2-methyl-5-propan-2-ylpyrrol-3-yl]prop-2-enenitrile (PubChem CID 142674907) has the molecular formula C24H24N2O3S and a molecular weight of 420.53 g/mol. Its IUPAC name is (E)-2-(benzenesulfonyl)-3-[1-(2-methoxyphenyl)-2-methyl-5-propan-2-ylpyrrol-3-yl]prop-2-enenitrile.
| Compound Name | (E)-2-(benzenesulfonyl)-3-[1-(2-methoxyphenyl)-2-methyl-5-propan-2-ylpyrrol-3-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 142674907 |
| Molecular Formula | C24H24N2O3S |
| Molecular Weight | 420.53 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | (E)-2-(benzenesulfonyl)-3-[1-(2-methoxyphenyl)-2-methyl-5-propan-2-ylpyrrol-3-yl]prop-2-enenitrile |
| SMILES | COc1ccccc1-n1c(C(C)C)cc(/C=C(\C#N)S(=O)(=O)c2ccccc2)c1C |
| InChI | InChI=1S/C24H24N2O3S/c1-17(2)23-15-19(18(3)26(23)22-12-8-9-13-24(22)29-4)14-21(16-25)30(27,28)20-10-6-5-7-11-20/h5-15,17H,1-4H3/b21-14+ |
| InChIKey | MWLJKYIOMQUENM-KGENOOAVSA-N |
| XLogP | 5.26 |
| TPSA | 72.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.53 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|