C26H28N2O2S — CID 142674784
(E)-2-(benzenesulfonyl)-3-[2-methyl-5-propan-2-yl-1-(2-propan-2-ylphenyl)pyrrol-3-yl]prop-2-enenitrile (PubChem CID 142674784) has the molecular formula C26H28N2O2S and a molecular weight of 432.59 g/mol. Its IUPAC name is (E)-2-(benzenesulfonyl)-3-[2-methyl-5-propan-2-yl-1-(2-propan-2-ylphenyl)pyrrol-3-yl]prop-2-enenitrile.
| Compound Name | (E)-2-(benzenesulfonyl)-3-[2-methyl-5-propan-2-yl-1-(2-propan-2-ylphenyl)pyrrol-3-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 142674784 |
| Molecular Formula | C26H28N2O2S |
| Molecular Weight | 432.59 g/mol |
| Exact Mass | 432.19 |
| IUPAC Name | (E)-2-(benzenesulfonyl)-3-[2-methyl-5-propan-2-yl-1-(2-propan-2-ylphenyl)pyrrol-3-yl]prop-2-enenitrile |
| SMILES | Cc1c(/C=C(\C#N)S(=O)(=O)c2ccccc2)cc(C(C)C)n1-c1ccccc1C(C)C |
| InChI | InChI=1S/C26H28N2O2S/c1-18(2)24-13-9-10-14-25(24)28-20(5)21(16-26(28)19(3)4)15-23(17-27)31(29,30)22-11-7-6-8-12-22/h6-16,18-19H,1-5H3/b23-15+ |
| InChIKey | IWACHTLLZWUMCX-HZHRSRAPSA-N |
| XLogP | 6.37 |
| TPSA | 62.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.59 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|