C23H24F3N3O — CID 142674917
(E)-2-(piperidine-1-carbonyl)-3-[5-propan-2-yl-1-[2-(trifluoromethyl)phenyl]pyrrol-3-yl]prop-2-enenitrile (PubChem CID 142674917) has the molecular formula C23H24F3N3O and a molecular weight of 415.46 g/mol. Its IUPAC name is (E)-2-(piperidine-1-carbonyl)-3-[5-propan-2-yl-1-[2-(trifluoromethyl)phenyl]pyrrol-3-yl]prop-2-enenitrile.
| Compound Name | (E)-2-(piperidine-1-carbonyl)-3-[5-propan-2-yl-1-[2-(trifluoromethyl)phenyl]pyrrol-3-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 142674917 |
| Molecular Formula | C23H24F3N3O |
| Molecular Weight | 415.46 g/mol |
| Exact Mass | 415.19 |
| IUPAC Name | (E)-2-(piperidine-1-carbonyl)-3-[5-propan-2-yl-1-[2-(trifluoromethyl)phenyl]pyrrol-3-yl]prop-2-enenitrile |
| SMILES | CC(C)c1cc(/C=C(\C#N)C(=O)N2CCCCC2)cn1-c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C23H24F3N3O/c1-16(2)21-13-17(12-18(14-27)22(30)28-10-6-3-7-11-28)15-29(21)20-9-5-4-8-19(20)23(24,25)26/h4-5,8-9,12-13,15-16H,3,6-7,10-11H2,1-2H3/b18-12+ |
| InChIKey | OMMRCTPOTZDBRA-LDADJPATSA-N |
| XLogP | 5.54 |
| TPSA | 49.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.46 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|