C24H25F6N3O2 — CID 142674705
(E)-2-cyano-N-ethyl-3-[1-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-2-methyl-5-propan-2-ylpyrrol-3-yl]-N-methylprop-2-enamide (PubChem CID 142674705) has the molecular formula C24H25F6N3O2 and a molecular weight of 501.47 g/mol. Its IUPAC name is (E)-2-cyano-N-ethyl-3-[1-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-2-methyl-5-propan-2-ylpyrrol-3-yl]-N-methylprop-2-enamide.
| Compound Name | (E)-2-cyano-N-ethyl-3-[1-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-2-methyl-5-propan-2-ylpyrrol-3-yl]-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 142674705 |
| Molecular Formula | C24H25F6N3O2 |
| Molecular Weight | 501.47 g/mol |
| Exact Mass | 501.19 |
| IUPAC Name | (E)-2-cyano-N-ethyl-3-[1-[4-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]-2-methyl-5-propan-2-ylpyrrol-3-yl]-N-methylprop-2-enamide |
| SMILES | CCN(C)C(=O)/C(C#N)=C/c1cc(C(C)C)n(-c2ccc(C(O)(C(F)(F)F)C(F)(F)F)cc2)c1C |
| InChI | InChI=1S/C24H25F6N3O2/c1-6-32(5)21(34)17(13-31)11-16-12-20(14(2)3)33(15(16)4)19-9-7-18(8-10-19)22(35,23(25,26)27)24(28,29)30/h7-12,14,35H,6H2,1-5H3/b17-11+ |
| InChIKey | PPLDILJUBLSAKA-GZTJUZNOSA-N |
| XLogP | 5.61 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.47 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|