C21H26N4O3S — CID 103599692
2-cyano-3-[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]-N-[2-(methanesulfonamido)ethyl]-N-methylprop-2-enamide (PubChem CID 103599692) has the molecular formula C21H26N4O3S and a molecular weight of 414.53 g/mol. Its IUPAC name is 2-cyano-3-[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]-N-[2-(methanesulfonamido)ethyl]-N-methylprop-2-enamide.
| Compound Name | 2-cyano-3-[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]-N-[2-(methanesulfonamido)ethyl]-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 103599692 |
| Molecular Formula | C21H26N4O3S |
| Molecular Weight | 414.53 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | 2-cyano-3-[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]-N-[2-(methanesulfonamido)ethyl]-N-methylprop-2-enamide |
| SMILES | Cc1ccc(-n2c(C)cc(C=C(C#N)C(=O)N(C)CCNS(C)(=O)=O)c2C)cc1 |
| InChI | InChI=1S/C21H26N4O3S/c1-15-6-8-20(9-7-15)25-16(2)12-18(17(25)3)13-19(14-22)21(26)24(4)11-10-23-29(5,27)28/h6-9,12-13,23H,10-11H2,1-5H3 |
| InChIKey | NQCOIWRRQGQPMS-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 95.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.53 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|