C23H26N4O2 — CID 78777673
2-(4-acetylpiperazine-1-carbonyl)-3-[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]prop-2-enenitrile (PubChem CID 78777673) has the molecular formula C23H26N4O2 and a molecular weight of 390.49 g/mol. Its IUPAC name is 2-(4-acetylpiperazine-1-carbonyl)-3-[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]prop-2-enenitrile.
| Compound Name | 2-(4-acetylpiperazine-1-carbonyl)-3-[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 78777673 |
| Molecular Formula | C23H26N4O2 |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.21 |
| IUPAC Name | 2-(4-acetylpiperazine-1-carbonyl)-3-[2,5-dimethyl-1-(4-methylphenyl)pyrrol-3-yl]prop-2-enenitrile |
| SMILES | CC(=O)N1CCN(C(=O)C(C#N)=Cc2cc(C)n(-c3ccc(C)cc3)c2C)CC1 |
| InChI | InChI=1S/C23H26N4O2/c1-16-5-7-22(8-6-16)27-17(2)13-20(18(27)3)14-21(15-24)23(29)26-11-9-25(10-12-26)19(4)28/h5-8,13-14H,9-12H2,1-4H3 |
| InChIKey | UQUXTDRBIPCUDO-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 69.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|