C28H34N4O3 — CID 75127562
3-[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]-2-[4-(piperidine-1-carbonyl)piperidine-1-carbonyl]prop-2-enenitrile (PubChem CID 75127562) has the molecular formula C28H34N4O3 and a molecular weight of 474.61 g/mol. Its IUPAC name is 3-[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]-2-[4-(piperidine-1-carbonyl)piperidine-1-carbonyl]prop-2-enenitrile.
| Compound Name | 3-[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]-2-[4-(piperidine-1-carbonyl)piperidine-1-carbonyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 75127562 |
| Molecular Formula | C28H34N4O3 |
| Molecular Weight | 474.61 g/mol |
| Exact Mass | 474.26 |
| IUPAC Name | 3-[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]-2-[4-(piperidine-1-carbonyl)piperidine-1-carbonyl]prop-2-enenitrile |
| SMILES | COc1ccc(-n2c(C)cc(C=C(C#N)C(=O)N3CCC(C(=O)N4CCCCC4)CC3)c2C)cc1 |
| InChI | InChI=1S/C28H34N4O3/c1-20-17-23(21(2)32(20)25-7-9-26(35-3)10-8-25)18-24(19-29)28(34)31-15-11-22(12-16-31)27(33)30-13-5-4-6-14-30/h7-10,17-18,22H,4-6,11-16H2,1-3H3 |
| InChIKey | ZPSMBQNCULGICL-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 78.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.61 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|