C30H32N4O3 — CID 39511528
N-[1-[(E)-2-cyano-3-[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]prop-2-enoyl]piperidin-4-yl]-2-methylbenzamide (PubChem CID 39511528) has the molecular formula C30H32N4O3 and a molecular weight of 496.61 g/mol. Its IUPAC name is N-[1-[(E)-2-cyano-3-[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]prop-2-enoyl]piperidin-4-yl]-2-methylbenzamide.
| Compound Name | N-[1-[(E)-2-cyano-3-[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]prop-2-enoyl]piperidin-4-yl]-2-methylbenzamide |
|---|---|
| PubChem CID | 39511528 |
| Molecular Formula | C30H32N4O3 |
| Molecular Weight | 496.61 g/mol |
| Exact Mass | 496.25 |
| IUPAC Name | N-[1-[(E)-2-cyano-3-[1-(4-methoxyphenyl)-2,5-dimethylpyrrol-3-yl]prop-2-enoyl]piperidin-4-yl]-2-methylbenzamide |
| SMILES | COc1ccc(-n2c(C)cc(/C=C(\C#N)C(=O)N3CCC(NC(=O)c4ccccc4C)CC3)c2C)cc1 |
| InChI | InChI=1S/C30H32N4O3/c1-20-7-5-6-8-28(20)29(35)32-25-13-15-33(16-14-25)30(36)24(19-31)18-23-17-21(2)34(22(23)3)26-9-11-27(37-4)12-10-26/h5-12,17-18,25H,13-16H2,1-4H3,(H,32,35)/b24-18+ |
| InChIKey | BUKWHETUZFKBLX-HKOYGPOVSA-N |
| XLogP | 4.74 |
| TPSA | 87.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.61 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|