C13H12ClF3N2 — CID 142918257
N-[(E)-[(E)-4-[2-chloro-4-(trifluoromethyl)phenyl]but-3-en-2-ylidene]amino]ethenamine (PubChem CID 142918257) has the molecular formula C13H12ClF3N2 and a molecular weight of 288.70 g/mol. Its IUPAC name is N-[(E)-[(E)-4-[2-chloro-4-(trifluoromethyl)phenyl]but-3-en-2-ylidene]amino]ethenamine.
| Compound Name | N-[(E)-[(E)-4-[2-chloro-4-(trifluoromethyl)phenyl]but-3-en-2-ylidene]amino]ethenamine |
|---|---|
| PubChem CID | 142918257 |
| Molecular Formula | C13H12ClF3N2 |
| Molecular Weight | 288.70 g/mol |
| Exact Mass | 288.06 |
| IUPAC Name | N-[(E)-[(E)-4-[2-chloro-4-(trifluoromethyl)phenyl]but-3-en-2-ylidene]amino]ethenamine |
| SMILES | C=CN/N=C(C)/C=C/c1ccc(C(F)(F)F)cc1Cl |
| InChI | InChI=1S/C13H12ClF3N2/c1-3-18-19-9(2)4-5-10-6-7-11(8-12(10)14)13(15,16)17/h3-8,18H,1H2,2H3/b5-4+,19-9+ |
| InChIKey | MNFOACBBJPEWTC-MTHWDJQVSA-N |
| XLogP | 4.48 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.70 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|