C10H10F3N3 — CID 172946963
N'-(ethenylamino)-3-(trifluoromethyl)benzenecarboximidamide (PubChem CID 172946963) has the molecular formula C10H10F3N3 and a molecular weight of 229.21 g/mol. Its IUPAC name is N'-(ethenylamino)-3-(trifluoromethyl)benzenecarboximidamide.
| Compound Name | N'-(ethenylamino)-3-(trifluoromethyl)benzenecarboximidamide |
|---|---|
| PubChem CID | 172946963 |
| Molecular Formula | C10H10F3N3 |
| Molecular Weight | 229.21 g/mol |
| Exact Mass | 229.08 |
| IUPAC Name | N'-(ethenylamino)-3-(trifluoromethyl)benzenecarboximidamide |
| SMILES | C=CN/N=C(\N)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C10H10F3N3/c1-2-15-16-9(14)7-4-3-5-8(6-7)10(11,12)13/h2-6,15H,1H2,(H2,14,16) |
| InChIKey | OTTWPJFZZWHXAP-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.21 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|