C13H13F3N4 — CID 163756438
[(Z)-4-(1-aminoethylideneamino)-4-azaniumylidene-1-[3-(trifluoromethyl)phenyl]but-2-enylidene]azanide (PubChem CID 163756438) has the molecular formula C13H13F3N4 and a molecular weight of 282.27 g/mol. Its IUPAC name is [(Z)-4-(1-aminoethylideneamino)-4-azaniumylidene-1-[3-(trifluoromethyl)phenyl]but-2-enylidene]azanide.
| Compound Name | [(Z)-4-(1-aminoethylideneamino)-4-azaniumylidene-1-[3-(trifluoromethyl)phenyl]but-2-enylidene]azanide |
|---|---|
| PubChem CID | 163756438 |
| Molecular Formula | C13H13F3N4 |
| Molecular Weight | 282.27 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | [(Z)-4-(1-aminoethylideneamino)-4-azaniumylidene-1-[3-(trifluoromethyl)phenyl]but-2-enylidene]azanide |
| SMILES | C/C(N)=N\C(=[NH2+])/C=C\C(=[N-])c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H12F3N4/c1-8(17)20-12(19)6-5-11(18)9-3-2-4-10(7-9)13(14,15)16/h2-7H,1H3,(H3,17,19,20)/q-1/p+1/b6-5- |
| InChIKey | LULVOIGSZQYAAF-WAYWQWQTSA-O |
| XLogP | 1.15 |
| TPSA | 86.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.27 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|