C10H13F3N5O3+ — CID 126960444
dihydroxy(oxo)azanium;2-[(E)-1-[3-(trifluoromethyl)phenyl]ethylideneamino]guanidine (PubChem CID 126960444) has the molecular formula C10H13F3N5O3+ and a molecular weight of 308.24 g/mol. Its IUPAC name is dihydroxy(oxo)azanium;2-[(E)-1-[3-(trifluoromethyl)phenyl]ethylideneamino]guanidine.
| Compound Name | dihydroxy(oxo)azanium;2-[(E)-1-[3-(trifluoromethyl)phenyl]ethylideneamino]guanidine |
|---|---|
| PubChem CID | 126960444 |
| Molecular Formula | C10H13F3N5O3+ |
| Molecular Weight | 308.24 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | dihydroxy(oxo)azanium;2-[(E)-1-[3-(trifluoromethyl)phenyl]ethylideneamino]guanidine |
| SMILES | C/C(=N\N=C(N)N)c1cccc(C(F)(F)F)c1.O=[N+](O)O |
| InChI | InChI=1S/C10H11F3N4.H2NO3/c1-6(16-17-9(14)15)7-3-2-4-8(5-7)10(11,12)13;2-1(3)4/h2-5H,1H3,(H4,14,15,17);(H2,2,3,4)/q;+1/b16-6+; |
| InChIKey | HQXIYBOFJILNPY-FPUQOWELSA-N |
| XLogP | 1.25 |
| TPSA | 137.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.24 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|