C8H6ClN4+ — CID 6932804
2-amino-6-chloro-4-methylpyridin-1-ium-3,5-dicarbonitrile (PubChem CID 6932804) has the molecular formula C8H6ClN4+ and a molecular weight of 193.62 g/mol. Its IUPAC name is 2-amino-6-chloro-4-methylpyridin-1-ium-3,5-dicarbonitrile.
| Compound Name | 2-amino-6-chloro-4-methylpyridin-1-ium-3,5-dicarbonitrile |
|---|---|
| PubChem CID | 6932804 |
| Molecular Formula | C8H6ClN4+ |
| Molecular Weight | 193.62 g/mol |
| Exact Mass | 193.03 |
| IUPAC Name | 2-amino-6-chloro-4-methylpyridin-1-ium-3,5-dicarbonitrile |
| SMILES | Cc1c(C#N)c(N)[nH+]c(Cl)c1C#N |
| InChI | InChI=1S/C8H5ClN4/c1-4-5(2-10)7(9)13-8(12)6(4)3-11/h1H3,(H2,12,13)/p+1 |
| InChIKey | KXEZBQTZEBDTNH-UHFFFAOYSA-O |
| XLogP | 0.79 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.62 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|