C20H17N4O+ — CID 4122061
2-amino-5-[(4-methoxyphenyl)methylidene]-4,6-dimethylcyclopenta[b]pyridin-1-ium-3,7-dicarbonitrile (PubChem CID 4122061) has the molecular formula C20H17N4O+ and a molecular weight of 329.38 g/mol. Its IUPAC name is 2-amino-5-[(4-methoxyphenyl)methylidene]-4,6-dimethylcyclopenta[b]pyridin-1-ium-3,7-dicarbonitrile.
| Compound Name | 2-amino-5-[(4-methoxyphenyl)methylidene]-4,6-dimethylcyclopenta[b]pyridin-1-ium-3,7-dicarbonitrile |
|---|---|
| PubChem CID | 4122061 |
| Molecular Formula | C20H17N4O+ |
| Molecular Weight | 329.38 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | 2-amino-5-[(4-methoxyphenyl)methylidene]-4,6-dimethylcyclopenta[b]pyridin-1-ium-3,7-dicarbonitrile |
| SMILES | COc1ccc(C=C2C(C)=C(C#N)c3[nH+]c(N)c(C#N)c(C)c32)cc1 |
| InChI | InChI=1S/C20H16N4O/c1-11-15(8-13-4-6-14(25-3)7-5-13)18-12(2)17(10-22)20(23)24-19(18)16(11)9-21/h4-8H,1-3H3,(H2,23,24)/p+1 |
| InChIKey | KWVDDBVJSTWDAD-UHFFFAOYSA-O |
| XLogP | 3.12 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.38 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_cyano_B(7)', 'substructure': 'N/A'} |
|---|