C21H18N5O4+ — CID 6982309
2-amino-5-[(4,5-dimethoxy-2-nitrophenyl)methylidene]-4,6-dimethylcyclopenta[b]pyridin-1-ium-3,7-dicarbonitrile (PubChem CID 6982309) has the molecular formula C21H18N5O4+ and a molecular weight of 404.41 g/mol. Its IUPAC name is 2-amino-5-[(4,5-dimethoxy-2-nitrophenyl)methylidene]-4,6-dimethylcyclopenta[b]pyridin-1-ium-3,7-dicarbonitrile.
| Compound Name | 2-amino-5-[(4,5-dimethoxy-2-nitrophenyl)methylidene]-4,6-dimethylcyclopenta[b]pyridin-1-ium-3,7-dicarbonitrile |
|---|---|
| PubChem CID | 6982309 |
| Molecular Formula | C21H18N5O4+ |
| Molecular Weight | 404.41 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | 2-amino-5-[(4,5-dimethoxy-2-nitrophenyl)methylidene]-4,6-dimethylcyclopenta[b]pyridin-1-ium-3,7-dicarbonitrile |
| SMILES | COc1cc(C=C2C(C)=C(C#N)c3[nH+]c(N)c(C#N)c(C)c32)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C21H17N5O4/c1-10-13(5-12-6-17(29-3)18(30-4)7-16(12)26(27)28)19-11(2)15(9-23)21(24)25-20(19)14(10)8-22/h5-7H,1-4H3,(H2,24,25)/p+1 |
| InChIKey | BGPDOACMIROVLS-UHFFFAOYSA-O |
| XLogP | 3.04 |
| TPSA | 149.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.41 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_cyano_B(7)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|