C21H17N4O2+ — CID 6969713
methyl 4-[(2-amino-3,7-dicyano-4,6-dimethylcyclopenta[b]pyridin-1-ium-5-ylidene)methyl]benzoate (PubChem CID 6969713) has the molecular formula C21H17N4O2+ and a molecular weight of 357.39 g/mol. Its IUPAC name is methyl 4-[(2-amino-3,7-dicyano-4,6-dimethylcyclopenta[b]pyridin-1-ium-5-ylidene)methyl]benzoate.
| Compound Name | methyl 4-[(2-amino-3,7-dicyano-4,6-dimethylcyclopenta[b]pyridin-1-ium-5-ylidene)methyl]benzoate |
|---|---|
| PubChem CID | 6969713 |
| Molecular Formula | C21H17N4O2+ |
| Molecular Weight | 357.39 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | methyl 4-[(2-amino-3,7-dicyano-4,6-dimethylcyclopenta[b]pyridin-1-ium-5-ylidene)methyl]benzoate |
| SMILES | COC(=O)c1ccc(C=C2C(C)=C(C#N)c3[nH+]c(N)c(C#N)c(C)c32)cc1 |
| InChI | InChI=1S/C21H16N4O2/c1-11-15(8-13-4-6-14(7-5-13)21(26)27-3)18-12(2)17(10-23)20(24)25-19(18)16(11)9-22/h4-8H,1-3H3,(H2,24,25)/p+1 |
| InChIKey | GSNSXRJLZYJKFL-UHFFFAOYSA-O |
| XLogP | 2.90 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.39 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_cyano_B(7)', 'substructure': 'N/A'} |
|---|