C27H20N4O3 — CID 2018822
4-[[4-[(E)-(2-amino-3,7-dicyano-4,6-dimethylcyclopenta[b]pyridin-1-ium-5-ylidene)methyl]phenoxy]methyl]benzoate (PubChem CID 2018822) has the molecular formula C27H20N4O3 and a molecular weight of 448.48 g/mol. Its IUPAC name is 4-[[4-[(E)-(2-amino-3,7-dicyano-4,6-dimethylcyclopenta[b]pyridin-1-ium-5-ylidene)methyl]phenoxy]methyl]benzoate.
| Compound Name | 4-[[4-[(E)-(2-amino-3,7-dicyano-4,6-dimethylcyclopenta[b]pyridin-1-ium-5-ylidene)methyl]phenoxy]methyl]benzoate |
|---|---|
| PubChem CID | 2018822 |
| Molecular Formula | C27H20N4O3 |
| Molecular Weight | 448.48 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | 4-[[4-[(E)-(2-amino-3,7-dicyano-4,6-dimethylcyclopenta[b]pyridin-1-ium-5-ylidene)methyl]phenoxy]methyl]benzoate |
| SMILES | CC1=C(C#N)c2[nH+]c(N)c(C#N)c(C)c2/C1=C/c1ccc(OCc2ccc(C(=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C27H20N4O3/c1-15-21(24-16(2)23(13-29)26(30)31-25(24)22(15)12-28)11-17-5-9-20(10-6-17)34-14-18-3-7-19(8-4-18)27(32)33/h3-11H,14H2,1-2H3,(H2,30,31)(H,32,33)/b21-11+ |
| InChIKey | LSXIPJHASXLBPA-SRZZPIQSSA-N |
| XLogP | 3.06 |
| TPSA | 137.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.48 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_cyano_B(7)', 'substructure': 'N/A'} |
|---|