C26H21N4O+ — CID 6959063
2-amino-4,6-dimethyl-5-[(4-phenylmethoxyphenyl)methylidene]cyclopenta[b]pyridin-1-ium-3,7-dicarbonitrile (PubChem CID 6959063) has the molecular formula C26H21N4O+ and a molecular weight of 405.48 g/mol. Its IUPAC name is 2-amino-4,6-dimethyl-5-[(4-phenylmethoxyphenyl)methylidene]cyclopenta[b]pyridin-1-ium-3,7-dicarbonitrile.
| Compound Name | 2-amino-4,6-dimethyl-5-[(4-phenylmethoxyphenyl)methylidene]cyclopenta[b]pyridin-1-ium-3,7-dicarbonitrile |
|---|---|
| PubChem CID | 6959063 |
| Molecular Formula | C26H21N4O+ |
| Molecular Weight | 405.48 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | 2-amino-4,6-dimethyl-5-[(4-phenylmethoxyphenyl)methylidene]cyclopenta[b]pyridin-1-ium-3,7-dicarbonitrile |
| SMILES | CC1=C(C#N)c2[nH+]c(N)c(C#N)c(C)c2C1=Cc1ccc(OCc2ccccc2)cc1 |
| InChI | InChI=1S/C26H20N4O/c1-16-21(24-17(2)23(14-28)26(29)30-25(24)22(16)13-27)12-18-8-10-20(11-9-18)31-15-19-6-4-3-5-7-19/h3-12H,15H2,1-2H3,(H2,29,30)/p+1 |
| InChIKey | FPZYAHXMEIIPPM-UHFFFAOYSA-O |
| XLogP | 4.69 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.48 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_cyano_B(7)', 'substructure': 'N/A'} |
|---|