C27H28N2O3 — CID 19111967
(5E)-4-methyl-2,6-dioxo-5-[(4-pentoxyphenyl)methylidene]-1-(2-phenylethyl)pyridine-3-carbonitrile (PubChem CID 19111967) has the molecular formula C27H28N2O3 and a molecular weight of 428.53 g/mol. Its IUPAC name is (5E)-4-methyl-2,6-dioxo-5-[(4-pentoxyphenyl)methylidene]-1-(2-phenylethyl)pyridine-3-carbonitrile.
| Compound Name | (5E)-4-methyl-2,6-dioxo-5-[(4-pentoxyphenyl)methylidene]-1-(2-phenylethyl)pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 19111967 |
| Molecular Formula | C27H28N2O3 |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.21 |
| IUPAC Name | (5E)-4-methyl-2,6-dioxo-5-[(4-pentoxyphenyl)methylidene]-1-(2-phenylethyl)pyridine-3-carbonitrile |
| SMILES | CCCCCOc1ccc(/C=C2/C(=O)N(CCc3ccccc3)C(=O)C(C#N)=C2C)cc1 |
| InChI | InChI=1S/C27H28N2O3/c1-3-4-8-17-32-23-13-11-22(12-14-23)18-24-20(2)25(19-28)27(31)29(26(24)30)16-15-21-9-6-5-7-10-21/h5-7,9-14,18H,3-4,8,15-17H2,1-2H3/b24-18+ |
| InChIKey | FCGLLVUUBLBHFB-HKOYGPOVSA-N |
| XLogP | 5.09 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_C(11)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|