C23H26N2O6 — CID 19113781
2-[2-[(5E)-3-cyano-4-methyl-2,6-dioxo-5-[(4-propoxyphenyl)methylidene]-1-pyridinyl]ethoxy]ethyl acetate (PubChem CID 19113781) has the molecular formula C23H26N2O6 and a molecular weight of 426.47 g/mol. Its IUPAC name is 2-[2-[(5E)-3-cyano-4-methyl-2,6-dioxo-5-[(4-propoxyphenyl)methylidene]-1-pyridinyl]ethoxy]ethyl acetate.
| Compound Name | 2-[2-[(5E)-3-cyano-4-methyl-2,6-dioxo-5-[(4-propoxyphenyl)methylidene]-1-pyridinyl]ethoxy]ethyl acetate |
|---|---|
| PubChem CID | 19113781 |
| Molecular Formula | C23H26N2O6 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | 2-[2-[(5E)-3-cyano-4-methyl-2,6-dioxo-5-[(4-propoxyphenyl)methylidene]-1-pyridinyl]ethoxy]ethyl acetate |
| SMILES | CCCOc1ccc(/C=C2/C(=O)N(CCOCCOC(C)=O)C(=O)C(C#N)=C2C)cc1 |
| InChI | InChI=1S/C23H26N2O6/c1-4-10-31-19-7-5-18(6-8-19)14-20-16(2)21(15-24)23(28)25(22(20)27)9-11-29-12-13-30-17(3)26/h5-8,14H,4,9-13H2,1-3H3/b20-14+ |
| InChIKey | SHUSPZJYDOAGRS-XSFVSMFZSA-N |
| XLogP | 2.65 |
| TPSA | 105.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyano_pyridone_C(11)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|