C27H21N5O4 — CID 5200881
2-amino-5-[[3-methoxy-4-[(3-nitrophenyl)methoxy]phenyl]methylidene]-4,6-dimethylcyclopenta[b]pyridine-3,7-dicarbonitrile (PubChem CID 5200881) has the molecular formula C27H21N5O4 and a molecular weight of 479.50 g/mol. Its IUPAC name is 2-amino-5-[[3-methoxy-4-[(3-nitrophenyl)methoxy]phenyl]methylidene]-4,6-dimethylcyclopenta[b]pyridine-3,7-dicarbonitrile.
| Compound Name | 2-amino-5-[[3-methoxy-4-[(3-nitrophenyl)methoxy]phenyl]methylidene]-4,6-dimethylcyclopenta[b]pyridine-3,7-dicarbonitrile |
|---|---|
| PubChem CID | 5200881 |
| Molecular Formula | C27H21N5O4 |
| Molecular Weight | 479.50 g/mol |
| Exact Mass | 479.16 |
| IUPAC Name | 2-amino-5-[[3-methoxy-4-[(3-nitrophenyl)methoxy]phenyl]methylidene]-4,6-dimethylcyclopenta[b]pyridine-3,7-dicarbonitrile |
| SMILES | COc1cc(C=C2C(C)=C(C#N)c3nc(N)c(C#N)c(C)c32)ccc1OCc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C27H21N5O4/c1-15-20(25-16(2)22(13-29)27(30)31-26(25)21(15)12-28)10-17-7-8-23(24(11-17)35-3)36-14-18-5-4-6-19(9-18)32(33)34/h4-11H,14H2,1-3H3,(H2,30,31) |
| InChIKey | HJBJFSBMIZTUQV-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 148.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.50 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_cyano_B(7)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|