C21H18N4O2 — CID 1082923
2-amino-5-[(2,5-dimethoxyphenyl)methylidene]-4,6-dimethylcyclopenta[b]pyridine-3,7-dicarbonitrile (PubChem CID 1082923) has the molecular formula C21H18N4O2 and a molecular weight of 358.40 g/mol. Its IUPAC name is 2-amino-5-[(2,5-dimethoxyphenyl)methylidene]-4,6-dimethylcyclopenta[b]pyridine-3,7-dicarbonitrile.
| Compound Name | 2-amino-5-[(2,5-dimethoxyphenyl)methylidene]-4,6-dimethylcyclopenta[b]pyridine-3,7-dicarbonitrile |
|---|---|
| PubChem CID | 1082923 |
| Molecular Formula | C21H18N4O2 |
| Molecular Weight | 358.40 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | 2-amino-5-[(2,5-dimethoxyphenyl)methylidene]-4,6-dimethylcyclopenta[b]pyridine-3,7-dicarbonitrile |
| SMILES | COc1ccc(OC)c(C=C2C(C)=C(C#N)c3nc(N)c(C#N)c(C)c32)c1 |
| InChI | InChI=1S/C21H18N4O2/c1-11-15(8-13-7-14(26-3)5-6-18(13)27-4)19-12(2)17(10-23)21(24)25-20(19)16(11)9-22/h5-8H,1-4H3,(H2,24,25) |
| InChIKey | ODFLYPQEPWQGEL-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 104.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.40 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_cyano_B(7)', 'substructure': 'N/A'} |
|---|