C21H17ClN4O — CID 3899909
2-amino-5-[(5-chloro-2-ethoxyphenyl)methylidene]-4,6-dimethylcyclopenta[b]pyridine-3,7-dicarbonitrile (PubChem CID 3899909) has the molecular formula C21H17ClN4O and a molecular weight of 376.85 g/mol. Its IUPAC name is 2-amino-5-[(5-chloro-2-ethoxyphenyl)methylidene]-4,6-dimethylcyclopenta[b]pyridine-3,7-dicarbonitrile.
| Compound Name | 2-amino-5-[(5-chloro-2-ethoxyphenyl)methylidene]-4,6-dimethylcyclopenta[b]pyridine-3,7-dicarbonitrile |
|---|---|
| PubChem CID | 3899909 |
| Molecular Formula | C21H17ClN4O |
| Molecular Weight | 376.85 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | 2-amino-5-[(5-chloro-2-ethoxyphenyl)methylidene]-4,6-dimethylcyclopenta[b]pyridine-3,7-dicarbonitrile |
| SMILES | CCOc1ccc(Cl)cc1C=C1C(C)=C(C#N)c2nc(N)c(C#N)c(C)c21 |
| InChI | InChI=1S/C21H17ClN4O/c1-4-27-18-6-5-14(22)7-13(18)8-15-11(2)16(9-23)20-19(15)12(3)17(10-24)21(25)26-20/h5-8H,4H2,1-3H3,(H2,25,26) |
| InChIKey | DTJLSPQFKVIQBJ-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 95.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.85 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_cyano_B(7)', 'substructure': 'N/A'} |
|---|