C22H18N4O3 — CID 98075331
(2R)-2-[4-[(Z)-(2-amino-3,7-dicyano-4,6-dimethylcyclopenta[b]pyridin-5-ylidene)methyl]phenoxy]propanoic acid (PubChem CID 98075331) has the molecular formula C22H18N4O3 and a molecular weight of 386.41 g/mol. Its IUPAC name is (2R)-2-[4-[(Z)-(2-amino-3,7-dicyano-4,6-dimethylcyclopenta[b]pyridin-5-ylidene)methyl]phenoxy]propanoic acid.
| Compound Name | (2R)-2-[4-[(Z)-(2-amino-3,7-dicyano-4,6-dimethylcyclopenta[b]pyridin-5-ylidene)methyl]phenoxy]propanoic acid |
|---|---|
| PubChem CID | 98075331 |
| Molecular Formula | C22H18N4O3 |
| Molecular Weight | 386.41 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | (2R)-2-[4-[(Z)-(2-amino-3,7-dicyano-4,6-dimethylcyclopenta[b]pyridin-5-ylidene)methyl]phenoxy]propanoic acid |
| SMILES | CC1=C(C#N)c2nc(N)c(C#N)c(C)c2/C1=C\c1ccc(O[C@H](C)C(=O)O)cc1 |
| InChI | InChI=1S/C22H18N4O3/c1-11-16(8-14-4-6-15(7-5-14)29-13(3)22(27)28)19-12(2)18(10-24)21(25)26-20(19)17(11)9-23/h4-8,13H,1-3H3,(H2,25,26)(H,27,28)/b16-8-/t13-/m1/s1 |
| InChIKey | DCNBXWWNPKTTHA-KHAFMBKQSA-N |
| XLogP | 3.55 |
| TPSA | 133.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.41 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_cyano_B(7)', 'substructure': 'N/A'} |
|---|